![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ans to R#1.cwk (WP).pdf | 2008-09-09 18:43 | 38K | |
| Ans to R#2.pdf | 2008-10-09 18:41 | 43K | |
| Ans to R#3.pdf | 2009-03-27 20:41 | 34K | |
| Ans to Review #4.pdf | 2009-04-26 19:39 | 31K | |
| Applications of Functions.pdf | 2009-01-27 17:53 | 35K | |
| Box With Top_Pizza Box.pdf | 2008-10-17 03:58 | 33K | |
| Combining Functions.pdf | 2009-02-13 03:37 | 65K | |
| Compound Interest.pdf | 2008-11-03 02:58 | 34K | |
| Data on TI-83_84.pdf | 2009-02-13 03:39 | 26K | |
| Directory of Graphs.pdf | 2008-09-02 18:12 | 55K | |
| Identifying Functions.pdf | 2008-08-20 18:02 | 40K | |
| Intro to Graphing.pdf | 2009-01-27 17:51 | 43K | |
| Modeling Problems.pdf | 2008-08-20 17:25 | 35K | |
| More Apps of Exps and Logs.pdf | 2009-04-24 14:59 | 71K | |
| Review #1.pdf | 2009-01-27 17:52 | 47K | |
| Review #2.pdf | 2009-02-20 13:26 | 56K | |
| Review #3.pdf | 2009-03-27 20:40 | 45K | |
| Review for Test #4.pdf | 2009-04-22 21:52 | 40K | |
| Roll 'em.pdf | 2008-09-09 19:03 | 60K | |